C28H42F3N3O4 — CID 174026636
(2S,3R,4R,5R,6R)-6-[[3-[[3-(cyclobutylmethyl)cyclopentyl]methyl]cyclopentyl]methyl]-6-methyl-3-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]oxane-2,4,5-triol (PubChem CID 174026636) has the molecular formula C28H42F3N3O4 and a molecular weight of 541.66 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-6-[[3-[[3-(cyclobutylmethyl)cyclopentyl]methyl]cyclopentyl]methyl]-6-methyl-3-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]oxane-2,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6R)-6-[[3-[[3-(cyclobutylmethyl)cyclopentyl]methyl]cyclopentyl]methyl]-6-methyl-3-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]oxane-2,4,5-triol |
|---|---|
| PubChem CID | 174026636 |
| Molecular Formula | C28H42F3N3O4 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | (2S,3R,4R,5R,6R)-6-[[3-[[3-(cyclobutylmethyl)cyclopentyl]methyl]cyclopentyl]methyl]-6-methyl-3-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]oxane-2,4,5-triol |
| SMILES | C[C@]1(CC2CCC(CC3CCC(CC4CCC4)C3)C2)O[C@H](O)[C@H](Nc2ccnc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C28H42F3N3O4/c1-27(15-20-8-7-19(14-20)13-18-6-5-17(12-18)11-16-3-2-4-16)24(36)23(35)22(25(37)38-27)33-21-9-10-32-26(34-21)28(29,30)31/h9-10,16-20,22-25,35-37H,2-8,11-15H2,1H3,(H,32,33,34)/t17?,18?,19?,20?,22-,23-,24-,25+,27-/m1/s1 |
| InChIKey | WVJXBSHPMXHNRG-KZYMLKSMSA-N |
| XLogP | 4.91 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |