C14H20FN3 — CID 174027021
(4E)-3-(4-fluorocyclobuta-1,3-dien-1-yl)imino-N',2,5-trimethylhepta-1,4-diene-1,7-diamine (PubChem CID 174027021) has the molecular formula C14H20FN3 and a molecular weight of 249.33 g/mol. Its IUPAC name is (4E)-3-(4-fluorocyclobuta-1,3-dien-1-yl)imino-N',2,5-trimethylhepta-1,4-diene-1,7-diamine.
| Compound Name | (4E)-3-(4-fluorocyclobuta-1,3-dien-1-yl)imino-N',2,5-trimethylhepta-1,4-diene-1,7-diamine |
|---|---|
| PubChem CID | 174027021 |
| Molecular Formula | C14H20FN3 |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (4E)-3-(4-fluorocyclobuta-1,3-dien-1-yl)imino-N',2,5-trimethylhepta-1,4-diene-1,7-diamine |
| SMILES | CNCC/C(C)=C/C(=N/C1=CC=C1F)C(C)=CN |
| InChI | InChI=1S/C14H20FN3/c1-10(6-7-17-3)8-14(11(2)9-16)18-13-5-4-12(13)15/h4-5,8-9,17H,6-7,16H2,1-3H3/b10-8+,11-9?,18-14- |
| InChIKey | AGLHVGQBCDSVNO-JZCZYNQXSA-N |
| XLogP | 2.60 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|