C40H72N8 — CID 174027125
5,14,23,35-tetraethyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 174027125) has the molecular formula C40H72N8 and a molecular weight of 665.07 g/mol. Its IUPAC name is 5,14,23,35-tetraethyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 5,14,23,35-tetraethyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 174027125 |
| Molecular Formula | C40H72N8 |
| Molecular Weight | 665.07 g/mol |
| Exact Mass | 664.59 |
| IUPAC Name | 5,14,23,35-tetraethyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | CCC1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCC(CC)C61)C1CCCC(CC)C51)C1C(CC)CCCC41 |
| InChI | InChI=1S/C40H72N8/c1-5-21-13-9-17-25-29(21)37-42-33(25)41-34-26-18-10-15-23(7-3)31(26)39(43-34)48-40-32-24(8-4)16-12-20-28(32)36(47-40)46-38-30-22(6-2)14-11-19-27(30)35(44-37)45-38/h21-48H,5-20H2,1-4H3 |
| InChIKey | PLEHETSTSLGBQT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.07 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |