C25H40N6O2 — CID 174027211
5-(1-amino-3-methyliminoprop-1-en-2-yl)-2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-methoxyphenol (PubChem CID 174027211) has the molecular formula C25H40N6O2 and a molecular weight of 456.64 g/mol. Its IUPAC name is 5-(1-amino-3-methyliminoprop-1-en-2-yl)-2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-methoxyphenol.
| Compound Name | 5-(1-amino-3-methyliminoprop-1-en-2-yl)-2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-methoxyphenol |
|---|---|
| PubChem CID | 174027211 |
| Molecular Formula | C25H40N6O2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 5-(1-amino-3-methyliminoprop-1-en-2-yl)-2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-methoxyphenol |
| SMILES | C/N=C/C(=CN)c1cc(O)c(/C(N)=C/C=C(\N)N(C)C2CC(C)(C)NC(C)(C)C2)c(OC)c1 |
| InChI | InChI=1S/C25H40N6O2/c1-24(2)12-18(13-25(3,4)30-24)31(6)22(28)9-8-19(27)23-20(32)10-16(11-21(23)33-7)17(14-26)15-29-5/h8-11,14-15,18,30,32H,12-13,26-28H2,1-7H3/b17-14?,19-8-,22-9+,29-15+ |
| InChIKey | LGOJOKHZHAKOHA-MYHVHTKHSA-N |
| XLogP | 2.74 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|