C27H36N4O3 — CID 17402759
2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide (PubChem CID 17402759) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 17402759 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CN3CCCC3c3ccc4c(c3)OCCCO4)cc2)CC1 |
| InChI | InChI=1S/C27H36N4O3/c1-2-29-13-15-30(16-14-29)23-9-7-22(8-10-23)28-27(32)20-31-12-3-5-24(31)21-6-11-25-26(19-21)34-18-4-17-33-25/h6-11,19,24H,2-5,12-18,20H2,1H3,(H,28,32) |
| InChIKey | YSWCXFNUDOYGJS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|