C64H58B11N3S — CID 174027904
CID 174027904 (PubChem CID 174027904) has the molecular formula C64H58B11N3S and a molecular weight of 1020.19 g/mol.
| Compound Name | CID 174027904 |
|---|---|
| PubChem CID | 174027904 |
| Molecular Formula | C64H58B11N3S |
| Molecular Weight | 1020.19 g/mol |
| Exact Mass | 1021.54 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(N(c2cc3c4c(c2)N2c5c(cc(C(C)(C)C)cc5C5(C)CCCCC25C)B4c2ccc4c(sc5cc(C(C)(C)C)ccc54)c2N3c2c(C)cc(C(C)(C)C)cc2C)c2c([B])c([B])c([B])c([B])c2[B])c([B])c1[B] |
| InChI | InChI=1S/C64H58B11N3S/c1-29-22-32(61(6,7)8)23-30(2)54(29)77-40-27-34(76(57-49(71)45(67)43(65)46(68)50(57)72)58-51(73)47(69)44(66)48(70)52(58)74)28-41-53(40)75(38-19-18-36-35-17-16-31(60(3,4)5)26-42(35)79-59(36)56(38)77)39-25-33(62(9,10)11)24-37-55(39)78(41)64(13)21-15-14-20-63(37,64)12/h16-19,22-28H,14-15,20-21H2,1-13H3 |
| InChIKey | RJOFSTNEPRIBLK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 79 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|