C21H26BN7O2 — CID 174027983
CID 174027983 (PubChem CID 174027983) has the molecular formula C21H26BN7O2 and a molecular weight of 419.30 g/mol.
| Compound Name | CID 174027983 |
|---|---|
| PubChem CID | 174027983 |
| Molecular Formula | C21H26BN7O2 |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | — |
| SMILES | [B]c1c(Nc2ncc3cc(C#N)n([C@H]4COCC4C)c3n2)c(OC(CC)CC)nn1C |
| InChI | InChI=1S/C21H26BN7O2/c1-5-15(6-2)31-20-17(18(22)28(4)27-20)25-21-24-9-13-7-14(8-23)29(19(13)26-21)16-11-30-10-12(16)3/h7,9,12,15-16H,5-6,10-11H2,1-4H3,(H,24,25,26)/t12?,16-/m0/s1 |
| InChIKey | PFWCIMAWKRKQDU-INSVYWFGSA-N |
| XLogP | 2.35 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|