C39H33BN2O2 — CID 174027986
[4-[4-[6-[(2E,4E)-5-cyclohepta-1,3,5-trien-1-ylhexa-2,4-dien-3-yl]-2-phenylpyrimidin-4-yl]naphthalen-1-yl]phenyl]boronic acid (PubChem CID 174027986) has the molecular formula C39H33BN2O2 and a molecular weight of 572.52 g/mol. Its IUPAC name is [4-[4-[6-[(2E,4E)-5-cyclohepta-1,3,5-trien-1-ylhexa-2,4-dien-3-yl]-2-phenylpyrimidin-4-yl]naphthalen-1-yl]phenyl]boronic acid.
| Compound Name | [4-[4-[6-[(2E,4E)-5-cyclohepta-1,3,5-trien-1-ylhexa-2,4-dien-3-yl]-2-phenylpyrimidin-4-yl]naphthalen-1-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 174027986 |
| Molecular Formula | C39H33BN2O2 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | [4-[4-[6-[(2E,4E)-5-cyclohepta-1,3,5-trien-1-ylhexa-2,4-dien-3-yl]-2-phenylpyrimidin-4-yl]naphthalen-1-yl]phenyl]boronic acid |
| SMILES | C/C=C(\C=C(/C)C1=CC=CC=CC1)c1cc(-c2ccc(-c3ccc(B(O)O)cc3)c3ccccc23)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C39H33BN2O2/c1-3-28(25-27(2)29-13-7-4-5-8-14-29)37-26-38(42-39(41-37)31-15-9-6-10-16-31)36-24-23-33(34-17-11-12-18-35(34)36)30-19-21-32(22-20-30)40(43)44/h3-13,15-26,43-44H,14H2,1-2H3/b27-25+,28-3+ |
| InChIKey | FKOXAFRSZDGYEH-YPMDOGFESA-N |
| XLogP | 8.10 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|