C26H38N2 — CID 174029032
1-[(1Z,7Z,9Z)-4-bicyclo[10.1.0]trideca-1,3,5,7,9,11-hexaenyl]-2-cycloundecyl-1-ethylhydrazine (PubChem CID 174029032) has the molecular formula C26H38N2 and a molecular weight of 378.60 g/mol. Its IUPAC name is 1-[(1Z,7Z,9Z)-4-bicyclo[10.1.0]trideca-1,3,5,7,9,11-hexaenyl]-2-cycloundecyl-1-ethylhydrazine.
| Compound Name | 1-[(1Z,7Z,9Z)-4-bicyclo[10.1.0]trideca-1,3,5,7,9,11-hexaenyl]-2-cycloundecyl-1-ethylhydrazine |
|---|---|
| PubChem CID | 174029032 |
| Molecular Formula | C26H38N2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | 1-[(1Z,7Z,9Z)-4-bicyclo[10.1.0]trideca-1,3,5,7,9,11-hexaenyl]-2-cycloundecyl-1-ethylhydrazine |
| SMILES | CCN(NC1CCCCCCCCCC1)C1=C/C=C2/CC2=C/C=C\C=C/C=C1 |
| InChI | InChI=1S/C26H38N2/c1-2-28(27-25-17-13-9-5-3-4-6-10-14-18-25)26-19-15-11-7-8-12-16-23-22-24(23)20-21-26/h7-8,11-12,15-16,19-21,25,27H,2-6,9-10,13-14,17-18,22H2,1H3/b8-7-,11-7-,12-8-,15-11?,16-12?,19-15?,21-20?,23-16?,24-20-,26-19?,26-21? |
| InChIKey | UUIUHSOGDCZTOC-OQURTLEYSA-N |
| XLogP | 6.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|