C26H26BCl2N3O3S — CID 174029051
N-[2-chloro-3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-(methoxymethyl)-[1,3]thiazolo[4,5-c]pyridin-4-amine (PubChem CID 174029051) has the molecular formula C26H26BCl2N3O3S and a molecular weight of 542.30 g/mol. Its IUPAC name is N-[2-chloro-3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-(methoxymethyl)-[1,3]thiazolo[4,5-c]pyridin-4-amine.
| Compound Name | N-[2-chloro-3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-(methoxymethyl)-[1,3]thiazolo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 174029051 |
| Molecular Formula | C26H26BCl2N3O3S |
| Molecular Weight | 542.30 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | N-[2-chloro-3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-(methoxymethyl)-[1,3]thiazolo[4,5-c]pyridin-4-amine |
| SMILES | COCc1nc2c(Nc3cccc(-c4cccc(B5OC(C)(C)C(C)(C)O5)c4Cl)c3Cl)nccc2s1 |
| InChI | InChI=1S/C26H26BCl2N3O3S/c1-25(2)26(3,4)35-27(34-25)17-10-6-8-15(21(17)28)16-9-7-11-18(22(16)29)31-24-23-19(12-13-30-24)36-20(32-23)14-33-5/h6-13H,14H2,1-5H3,(H,30,31) |
| InChIKey | DCLMVVLJXYMZRM-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.30 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|