About (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne
(E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne (PubChem CID 174029582) has the molecular formula C10H15F
and a molecular weight of 154.23 g/mol. Its IUPAC name is (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne.
Molecular Properties
| Compound Name | (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne |
| PubChem CID | 174029582 |
| Molecular Formula | C10H15F |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne |
| SMILES | CC#C/C(C)=C(/F)[C@@H](C)CC |
| InChI | InChI=1S/C10H15F/c1-5-7-9(4)10(11)8(3)6-2/h8H,6H2,1-4H3/b10-9+/t8-/m0/s1 |
| InChIKey | ZKDJZFVGFXVUOD-VPOJCXOPSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne?
The IUPAC name of (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne (CID 174029582) is (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne.
What is the SMILES notation for (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne?
The canonical SMILES for (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne is CC#C/C(C)=C(/F)[C@@H](C)CC.
What is the InChIKey of (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne?
The InChIKey is ZKDJZFVGFXVUOD-VPOJCXOPSA-N. The full InChI is InChI=1S/C10H15F/c1-5-7-9(4)10(11)8(3)6-2/h8H,6H2,1-4H3/b10-9+/t8-/m0/s1.
What are the key properties of (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne?
(E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne has a molecular weight of 154.23 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E,6S)-5-fluoro-4,6-dimethyloct-4-en-2-yne is sourced from PubChem (CID 174029582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).