C15H12FN — CID 174029634
14-fluoro-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,13,15-heptaene (PubChem CID 174029634) has the molecular formula C15H12FN and a molecular weight of 225.27 g/mol. Its IUPAC name is 14-fluoro-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,13,15-heptaene.
| Compound Name | 14-fluoro-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,13,15-heptaene |
|---|---|
| PubChem CID | 174029634 |
| Molecular Formula | C15H12FN |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 14-fluoro-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,13,15-heptaene |
| SMILES | Fc1ccc2c(c1)CCc1cccnc1C=C2 |
| InChI | InChI=1S/C15H12FN/c16-14-7-5-11-6-8-15-12(2-1-9-17-15)3-4-13(11)10-14/h1-2,5-10H,3-4H2 |
| InChIKey | FWKZLHGHUIKMBJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |