C12H21FSi — CID 174029667
[(3Z,5Z)-6-fluoro-5-methylocta-1,3,5-trien-2-yl]-trimethylsilane (PubChem CID 174029667) has the molecular formula C12H21FSi and a molecular weight of 212.38 g/mol. Its IUPAC name is [(3Z,5Z)-6-fluoro-5-methylocta-1,3,5-trien-2-yl]-trimethylsilane.
| Compound Name | [(3Z,5Z)-6-fluoro-5-methylocta-1,3,5-trien-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 174029667 |
| Molecular Formula | C12H21FSi |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | [(3Z,5Z)-6-fluoro-5-methylocta-1,3,5-trien-2-yl]-trimethylsilane |
| SMILES | C=C(/C=C\C(C)=C(/F)CC)[Si](C)(C)C |
| InChI | InChI=1S/C12H21FSi/c1-7-12(13)10(2)8-9-11(3)14(4,5)6/h8-9H,3,7H2,1-2,4-6H3/b9-8-,12-10- |
| InChIKey | RAGBELKLEYNTIT-DMGFJBLZSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|