C24H34N6O6 — CID 174029820
[(2R,3S,4R,5R)-5-[5-(N-butanoyl-N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate (PubChem CID 174029820) has the molecular formula C24H34N6O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-(N-butanoyl-N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate.
| Compound Name | [(2R,3S,4R,5R)-5-[5-(N-butanoyl-N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate |
|---|---|
| PubChem CID | 174029820 |
| Molecular Formula | C24H34N6O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-(N-butanoyl-N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate |
| SMILES | [H]/N=C/N=C(\NC(=O)CCC)c1ccc([C@]2(C#N)O[C@H](COC(=O)CC3(N)CCCCC3)[C@@H](O)[C@H]2O)[nH]1 |
| InChI | InChI=1S/C24H34N6O6/c1-2-6-18(31)30-22(28-14-26)15-7-8-17(29-15)24(13-25)21(34)20(33)16(36-24)12-35-19(32)11-23(27)9-4-3-5-10-23/h7-8,14,16,20-21,29,33-34H,2-6,9-12,27H2,1H3,(H2,26,28,30,31)/t16-,20-,21-,24+/m1/s1 |
| InChIKey | OBMBAMFRYCGMLR-QBUJUVIBSA-N |
| XLogP | 0.72 |
| TPSA | 206.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|