C12H12F9N — CID 174030170
(E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(E)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]pent-3-en-2-imine (PubChem CID 174030170) has the molecular formula C12H12F9N and a molecular weight of 341.22 g/mol. Its IUPAC name is (E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(E)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]pent-3-en-2-imine.
| Compound Name | (E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(E)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 174030170 |
| Molecular Formula | C12H12F9N |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(E)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]pent-3-en-2-imine |
| SMILES | CC/C(C)=C(/N=C(/C=C(\C)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F9N/c1-4-6(2)9(12(19,20)21)22-8(11(16,17)18)5-7(3)10(13,14)15/h5H,4H2,1-3H3/b7-5+,9-6+,22-8- |
| InChIKey | GKVQBAJFDFQLRI-OEVWCXIISA-N |
| XLogP | 5.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|