About CID 174030294
CID 174030294 (PubChem CID 174030294) has the molecular formula C24H18BF6N3O5
and a molecular weight of 553.22 g/mol.
Molecular Properties
| Compound Name | CID 174030294 |
| PubChem CID | 174030294 |
| Molecular Formula | C24H18BF6N3O5 |
| Molecular Weight | 553.22 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | — |
| SMILES | [B][C@@]1(N2Cc3cc(CNC(=O)C(F)(F)c4ccc(F)cc4OCC(F)(F)F)ccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C24H18BF6N3O5/c25-22(6-5-18(35)33-20(22)37)34-10-13-7-12(1-3-15(13)19(34)36)9-32-21(38)24(30,31)16-4-2-14(26)8-17(16)39-11-23(27,28)29/h1-4,7-8H,5-6,9-11H2,(H,32,38)(H,33,35,37)/t22-/m1/s1 |
| InChIKey | AFKRSAGAQQLFGM-JOCHJYFZSA-N |
| XLogP | 2.43 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 553.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 174030294 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174030294?
The IUPAC name of CID 174030294 (CID 174030294) is not available.
What is the SMILES notation for CID 174030294?
The canonical SMILES for CID 174030294 is [B][C@@]1(N2Cc3cc(CNC(=O)C(F)(F)c4ccc(F)cc4OCC(F)(F)F)ccc3C2=O)CCC(=O)NC1=O.
What is the InChIKey of CID 174030294?
The InChIKey is AFKRSAGAQQLFGM-JOCHJYFZSA-N. The full InChI is InChI=1S/C24H18BF6N3O5/c25-22(6-5-18(35)33-20(22)37)34-10-13-7-12(1-3-15(13)19(34)36)9-32-21(38)24(30,31)16-4-2-14(26)8-17(16)39-11-23(27,28)29/h1-4,7-8H,5-6,9-11H2,(H,32,38)(H,33,35,37)/t22-/m1/s1.
What are the key properties of CID 174030294?
CID 174030294 has a molecular weight of 553.22 g/mol, XLogP of 2.43, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174030294 is sourced from PubChem (CID 174030294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).