About (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine
(Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine (PubChem CID 174030403) has the molecular formula C9H15ClN2
and a molecular weight of 186.69 g/mol. Its IUPAC name is (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine.
Molecular Properties
| Compound Name | (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine |
| PubChem CID | 174030403 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine |
| SMILES | C=N/C(=C\C=NCCl)C(C)CC |
| InChI | InChI=1S/C9H15ClN2/c1-4-8(2)9(11-3)5-6-12-7-10/h5-6,8H,3-4,7H2,1-2H3/b9-5-,12-6? |
| InChIKey | IHENGMDMEQROAB-CDZVIQFASA-N |
| XLogP | 2.88 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine?
The IUPAC name of (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine (CID 174030403) is (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine.
What is the SMILES notation for (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine?
The canonical SMILES for (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine is C=N/C(=C\C=NCCl)C(C)CC.
What is the InChIKey of (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine?
The InChIKey is IHENGMDMEQROAB-CDZVIQFASA-N. The full InChI is InChI=1S/C9H15ClN2/c1-4-8(2)9(11-3)5-6-12-7-10/h5-6,8H,3-4,7H2,1-2H3/b9-5-,12-6?.
What are the key properties of (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine?
(Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine has a molecular weight of 186.69 g/mol, XLogP of 2.88, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N-(chloromethyl)-4-methyl-3-N-methylidenehex-2-ene-1,3-diimine is sourced from PubChem (CID 174030403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).