C32H60O8Si2 — CID 174030515
2-[(1S,3R,4'R,7R,9S,11R,13S)-5-[2-[tert-butyl(dimethyl)silyl]oxy-1-triethylsilyloxyethyl]-4',13-dimethylspiro[2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-11,6'-oxane]-2'-yl]acetic acid (PubChem CID 174030515) has the molecular formula C32H60O8Si2 and a molecular weight of 629.00 g/mol. Its IUPAC name is 2-[(1S,3R,4'R,7R,9S,11R,13S)-5-[2-[tert-butyl(dimethyl)silyl]oxy-1-triethylsilyloxyethyl]-4',13-dimethylspiro[2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-11,6'-oxane]-2'-yl]acetic acid.
| Compound Name | 2-[(1S,3R,4'R,7R,9S,11R,13S)-5-[2-[tert-butyl(dimethyl)silyl]oxy-1-triethylsilyloxyethyl]-4',13-dimethylspiro[2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-11,6'-oxane]-2'-yl]acetic acid |
|---|---|
| PubChem CID | 174030515 |
| Molecular Formula | C32H60O8Si2 |
| Molecular Weight | 629.00 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | 2-[(1S,3R,4'R,7R,9S,11R,13S)-5-[2-[tert-butyl(dimethyl)silyl]oxy-1-triethylsilyloxyethyl]-4',13-dimethylspiro[2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-11,6'-oxane]-2'-yl]acetic acid |
| SMILES | CC[Si](CC)(CC)OC(CO[Si](C)(C)C(C)(C)C)C1C[C@H]2O[C@@H]3[C@H](C[C@H]2O1)O[C@]1(C[C@H](C)CC(CC(=O)O)O1)C[C@@H]3C |
| InChI | InChI=1S/C32H60O8Si2/c1-11-42(12-2,13-3)40-28(20-35-41(9,10)31(6,7)8)26-16-25-24(36-26)17-27-30(37-25)22(5)19-32(39-27)18-21(4)14-23(38-32)15-29(33)34/h21-28,30H,11-20H2,1-10H3,(H,33,34)/t21-,22+,23?,24-,25-,26?,27+,28?,30+,32-/m1/s1 |
| InChIKey | GCEIRFTZPMLCPL-JSDCMXSGSA-N |
| XLogP | 7.12 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.00 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|