C12H17BFN3O2 — CID 174030837
CID 174030837 (PubChem CID 174030837) has the molecular formula C12H17BFN3O2 and a molecular weight of 265.10 g/mol.
| Compound Name | CID 174030837 |
|---|---|
| PubChem CID | 174030837 |
| Molecular Formula | C12H17BFN3O2 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | — |
| SMILES | [B]C(C)(F)OC1CC(c2nnc(CCC(=C)N)o2)C1 |
| InChI | InChI=1S/C12H17BFN3O2/c1-7(15)3-4-10-16-17-11(18-10)8-5-9(6-8)19-12(2,13)14/h8-9H,1,3-6,15H2,2H3 |
| InChIKey | KUMMEDVKLUQFAP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|