C31H38ClNO5 — CID 174031016
[(1R,2S,6R,10S,11S,13S,15R)-8-(chloromethyl)-1,6-dihydroxy-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetate (PubChem CID 174031016) has the molecular formula C31H38ClNO5 and a molecular weight of 540.10 g/mol. Its IUPAC name is [(1R,2S,6R,10S,11S,13S,15R)-8-(chloromethyl)-1,6-dihydroxy-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetate.
| Compound Name | [(1R,2S,6R,10S,11S,13S,15R)-8-(chloromethyl)-1,6-dihydroxy-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetate |
|---|---|
| PubChem CID | 174031016 |
| Molecular Formula | C31H38ClNO5 |
| Molecular Weight | 540.10 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | [(1R,2S,6R,10S,11S,13S,15R)-8-(chloromethyl)-1,6-dihydroxy-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetate |
| SMILES | CC1=C[C@H]2[C@@]3(O)[C@H](C)C[C@]4(OC(=O)[C@@H](N)C5Cc6ccccc6C5)[C@@H]([C@@H]3C=C(CCl)C[C@]2(O)C1=O)C4(C)C |
| InChI | InChI=1S/C31H38ClNO5/c1-16-9-23-29(36,26(16)34)14-18(15-32)10-22-25-28(3,4)30(25,13-17(2)31(22,23)37)38-27(35)24(33)21-11-19-7-5-6-8-20(19)12-21/h5-10,17,21-25,36-37H,11-15,33H2,1-4H3/t17-,22+,23-,24+,25+,29-,30+,31-/m1/s1 |
| InChIKey | SMTJOWQJBBXHII-MGSFFAOBSA-N |
| XLogP | 3.50 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.10 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|