About 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane
2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane (PubChem CID 174031147) has the molecular formula C6H6BrFO
and a molecular weight of 193.01 g/mol. Its IUPAC name is 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane.
Molecular Properties
| Compound Name | 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane |
| PubChem CID | 174031147 |
| Molecular Formula | C6H6BrFO |
| Molecular Weight | 193.01 g/mol |
| Exact Mass | 191.96 |
| IUPAC Name | 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane |
| SMILES | C=C(F)C=C(Br)C1CO1 |
| InChI | InChI=1S/C6H6BrFO/c1-4(8)2-5(7)6-3-9-6/h2,6H,1,3H2 |
| InChIKey | MKKNCQQVDJMLMD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.01 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane?
The IUPAC name of 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane (CID 174031147) is 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane.
What is the SMILES notation for 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane?
The canonical SMILES for 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane is C=C(F)C=C(Br)C1CO1.
What is the InChIKey of 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane?
The InChIKey is MKKNCQQVDJMLMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrFO/c1-4(8)2-5(7)6-3-9-6/h2,6H,1,3H2.
What are the key properties of 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane?
2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane has a molecular weight of 193.01 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-bromo-3-fluorobuta-1,3-dienyl)oxirane is sourced from PubChem (CID 174031147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).