C16H27NO — CID 174031613
N-ethyl-2-[(4E)-2-methoxy-4,6-dimethylcycloocta-1,4,7-trien-1-yl]-N-methylethanamine (PubChem CID 174031613) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-ethyl-2-[(4E)-2-methoxy-4,6-dimethylcycloocta-1,4,7-trien-1-yl]-N-methylethanamine.
| Compound Name | N-ethyl-2-[(4E)-2-methoxy-4,6-dimethylcycloocta-1,4,7-trien-1-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 174031613 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-ethyl-2-[(4E)-2-methoxy-4,6-dimethylcycloocta-1,4,7-trien-1-yl]-N-methylethanamine |
| SMILES | CCN(C)CCC1=C(OC)C/C(C)=C\C(C)C=C1 |
| InChI | InChI=1S/C16H27NO/c1-6-17(4)10-9-15-8-7-13(2)11-14(3)12-16(15)18-5/h7-8,11,13H,6,9-10,12H2,1-5H3/b8-7?,14-11-,16-15? |
| InChIKey | YRUKHLUDJQQNAX-PHHDOZBOSA-N |
| XLogP | 3.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|