C15H19N3O6S — CID 174031761
[(2S,5S)-7-oxo-2-(2-phenylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 174031761) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is [(2S,5S)-7-oxo-2-(2-phenylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5S)-7-oxo-2-(2-phenylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 174031761 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [(2S,5S)-7-oxo-2-(2-phenylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NCCc1ccccc1)[C@@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C15H19N3O6S/c19-14(16-9-8-11-4-2-1-3-5-11)13-7-6-12-10-17(13)15(20)18(12)24-25(21,22)23/h1-5,12-13H,6-10H2,(H,16,19)(H,21,22,23)/t12-,13-/m0/s1 |
| InChIKey | KUKCIQMMZZSBRJ-STQMWFEESA-N |
| XLogP | 0.35 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|