C25H46O3Si — CID 174032194
(3aR,4R,5R,7aS)-5-[(1S,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol (PubChem CID 174032194) has the molecular formula C25H46O3Si and a molecular weight of 422.73 g/mol. Its IUPAC name is (3aR,4R,5R,7aS)-5-[(1S,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol.
| Compound Name | (3aR,4R,5R,7aS)-5-[(1S,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol |
|---|---|
| PubChem CID | 174032194 |
| Molecular Formula | C25H46O3Si |
| Molecular Weight | 422.73 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | (3aR,4R,5R,7aS)-5-[(1S,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol |
| SMILES | C=C1CC[C@H]2[C@H](O)[C@@H]([C@@]3(C)CC[C@H](O)C[C@@H]3CO[Si](C)(C)C(C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C25H46O3Si/c1-17-9-10-20-22(27)21(12-14-24(17,20)5)25(6)13-11-19(26)15-18(25)16-28-29(7,8)23(2,3)4/h18-22,26-27H,1,9-16H2,2-8H3/t18-,19+,20+,21+,22+,24-,25+/m1/s1 |
| InChIKey | WWVNMYLWNXGSAP-CWOJUHNUSA-N |
| XLogP | 5.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.73 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|