C20H38N2O8Si2 — CID 174032206
2,4-bis[3-[methoxy(dimethyl)silyl]propylcarbamoyl]cyclobutane-1,3-dicarboxylic acid (PubChem CID 174032206) has the molecular formula C20H38N2O8Si2 and a molecular weight of 490.70 g/mol. Its IUPAC name is 2,4-bis[3-[methoxy(dimethyl)silyl]propylcarbamoyl]cyclobutane-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[3-[methoxy(dimethyl)silyl]propylcarbamoyl]cyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174032206 |
| Molecular Formula | C20H38N2O8Si2 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2,4-bis[3-[methoxy(dimethyl)silyl]propylcarbamoyl]cyclobutane-1,3-dicarboxylic acid |
| SMILES | CO[Si](C)(C)CCCNC(=O)C1C(C(=O)O)C(C(=O)NCCC[Si](C)(C)OC)C1C(=O)O |
| InChI | InChI=1S/C20H38N2O8Si2/c1-29-31(3,4)11-7-9-21-17(23)13-15(19(25)26)14(16(13)20(27)28)18(24)22-10-8-12-32(5,6)30-2/h13-16H,7-12H2,1-6H3,(H,21,23)(H,22,24)(H,25,26)(H,27,28) |
| InChIKey | JHZSIVFPGUSNOL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|