C18H13BIN — CID 174032462
5-iodo-10-phenylbenzo[b][1,4]benzazaborinine (PubChem CID 174032462) has the molecular formula C18H13BIN and a molecular weight of 381.03 g/mol. Its IUPAC name is 5-iodo-10-phenylbenzo[b][1,4]benzazaborinine.
| Compound Name | 5-iodo-10-phenylbenzo[b][1,4]benzazaborinine |
|---|---|
| PubChem CID | 174032462 |
| Molecular Formula | C18H13BIN |
| Molecular Weight | 381.03 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 5-iodo-10-phenylbenzo[b][1,4]benzazaborinine |
| SMILES | IN1c2ccccc2B(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H13BIN/c20-21-17-12-6-4-10-15(17)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)21/h1-13H |
| InChIKey | HRXAUEXHHXUBCM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.03 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|