C16H26N2 — CID 174032640
(3Z)-N,6-dimethyl-7-methylimino-N-[(3Z)-3-methylpenta-1,3-dien-2-yl]hepta-1,3-dien-4-amine (PubChem CID 174032640) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (3Z)-N,6-dimethyl-7-methylimino-N-[(3Z)-3-methylpenta-1,3-dien-2-yl]hepta-1,3-dien-4-amine.
| Compound Name | (3Z)-N,6-dimethyl-7-methylimino-N-[(3Z)-3-methylpenta-1,3-dien-2-yl]hepta-1,3-dien-4-amine |
|---|---|
| PubChem CID | 174032640 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (3Z)-N,6-dimethyl-7-methylimino-N-[(3Z)-3-methylpenta-1,3-dien-2-yl]hepta-1,3-dien-4-amine |
| SMILES | C=C/C=C(/CC(C)/C=N/C)N(C)C(=C)/C(C)=C\C |
| InChI | InChI=1S/C16H26N2/c1-8-10-16(11-13(3)12-17-6)18(7)15(5)14(4)9-2/h8-10,12-13H,1,5,11H2,2-4,6-7H3/b14-9-,16-10-,17-12+ |
| InChIKey | SUKXINNSFUYMOI-VEUCLFRSSA-N |
| XLogP | 4.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|