C22H28O4Si — CID 174032816
(1S,3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3-naphthalen-1-yl-2-oxabicyclo[3.1.0]hexan-6-one (PubChem CID 174032816) has the molecular formula C22H28O4Si and a molecular weight of 384.55 g/mol. Its IUPAC name is (1S,3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3-naphthalen-1-yl-2-oxabicyclo[3.1.0]hexan-6-one.
| Compound Name | (1S,3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3-naphthalen-1-yl-2-oxabicyclo[3.1.0]hexan-6-one |
|---|---|
| PubChem CID | 174032816 |
| Molecular Formula | C22H28O4Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (1S,3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3-naphthalen-1-yl-2-oxabicyclo[3.1.0]hexan-6-one |
| SMILES | CO[C@H]1[C@H](c2cccc3ccccc23)OC2C(=O)C21O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H28O4Si/c1-21(2,3)27(5,6)26-22-18(23)20(22)25-17(19(22)24-4)16-13-9-11-14-10-7-8-12-15(14)16/h7-13,17,19-20H,1-6H3/t17-,19-,20?,22?/m0/s1 |
| InChIKey | HYHJCODNUZTMGW-YZKIPRNKSA-N |
| XLogP | 4.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|