C17H16N8 — CID 17403320
(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile (PubChem CID 17403320) has the molecular formula C17H16N8 and a molecular weight of 332.37 g/mol. Its IUPAC name is (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 17403320 |
| Molecular Formula | C17H16N8 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile |
| SMILES | CN(C)c1nc(N)nc(/C(C#N)=C/c2cnn(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C17H16N8/c1-24(2)17-22-15(21-16(19)23-17)13(9-18)8-12-10-20-25(11-12)14-6-4-3-5-7-14/h3-8,10-11H,1-2H3,(H2,19,21,22,23)/b13-8+ |
| InChIKey | HIWKHZUVYLWPBY-MDWZMJQESA-N |
| XLogP | 1.77 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|