C24H25FN6OS — CID 174033294
2-[4-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-4-carbonitrile (PubChem CID 174033294) has the molecular formula C24H25FN6OS and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-[4-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-4-carbonitrile.
| Compound Name | 2-[4-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 174033294 |
| Molecular Formula | C24H25FN6OS |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-[4-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-4-carbonitrile |
| SMILES | CC[C@@H]1CCC[C@H](N(c2cnc(-c3ccc(-c4nc(C#N)cs4)cc3O)nn2)C2CC2)[C@@H]1F |
| InChI | InChI=1S/C24H25FN6OS/c1-2-14-4-3-5-19(22(14)25)31(17-7-8-17)21-12-27-23(30-29-21)18-9-6-15(10-20(18)32)24-28-16(11-26)13-33-24/h6,9-10,12-14,17,19,22,32H,2-5,7-8H2,1H3/t14-,19+,22-/m1/s1 |
| InChIKey | KUGWEFBNHWBKMO-YFYZNPQRSA-N |
| XLogP | 5.12 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |