C20H19ClF3N6OSSi — CID 174033481
CID 174033481 (PubChem CID 174033481) has the molecular formula C20H19ClF3N6OSSi and a molecular weight of 512.01 g/mol.
| Compound Name | CID 174033481 |
|---|---|
| PubChem CID | 174033481 |
| Molecular Formula | C20H19ClF3N6OSSi |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | — |
| SMILES | C[C@]1(C[Si])OCC2(CCN(c3cnc4c(cnn4-c4ccnc(C(F)(F)F)c4Cl)n3)CC2)S1 |
| InChI | InChI=1S/C20H19ClF3N6OSSi/c1-18(11-33)31-10-19(32-18)3-6-29(7-4-19)14-9-26-17-12(28-14)8-27-30(17)13-2-5-25-16(15(13)21)20(22,23)24/h2,5,8-9H,3-4,6-7,10-11H2,1H3/t18-/m0/s1 |
| InChIKey | HEBQALNUMVYMPV-SFHVURJKSA-N |
| XLogP | 4.29 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|