C41H55FN7O4SSi — CID 174033761
CID 174033761 (PubChem CID 174033761) has the molecular formula C41H55FN7O4SSi and a molecular weight of 789.09 g/mol.
| Compound Name | CID 174033761 |
|---|---|
| PubChem CID | 174033761 |
| Molecular Formula | C41H55FN7O4SSi |
| Molecular Weight | 789.09 g/mol |
| Exact Mass | 788.38 |
| IUPAC Name | — |
| SMILES | CCCCNC1CCN(c2ccc(C(=O)Nc3cccc(Sc4cnc(N5CCC6(CC5)COC([C@H](C)[Si])[C@H]6NC(=O)OC(C)(C)C)cn4)c3)cc2F)CC1 |
| InChI | InChI=1S/C41H55FN7O4SSi/c1-6-7-17-43-29-13-18-48(19-14-29)33-12-11-28(22-32(33)42)38(50)46-30-9-8-10-31(23-30)54-35-25-44-34(24-45-35)49-20-15-41(16-21-49)26-52-36(27(2)55)37(41)47-39(51)53-40(3,4)5/h8-12,22-25,27,29,36-37,43H,6-7,13-21,26H2,1-5H3,(H,46,50)(H,47,51)/t27-,36?,37+/m0/s1 |
| InChIKey | XVDIPOMFZFMTQL-AGWRDMDQSA-N |
| XLogP | 7.23 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.09 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|