C24H24FN3OS — CID 174034142
7-(aminomethylidene)-6-(4-fluorophenyl)imino-2-(3-methylphenyl)sulfanyl-1,3,4,8-tetrahydroisoquinoline-8a-carbaldehyde (PubChem CID 174034142) has the molecular formula C24H24FN3OS and a molecular weight of 421.54 g/mol. Its IUPAC name is 7-(aminomethylidene)-6-(4-fluorophenyl)imino-2-(3-methylphenyl)sulfanyl-1,3,4,8-tetrahydroisoquinoline-8a-carbaldehyde.
| Compound Name | 7-(aminomethylidene)-6-(4-fluorophenyl)imino-2-(3-methylphenyl)sulfanyl-1,3,4,8-tetrahydroisoquinoline-8a-carbaldehyde |
|---|---|
| PubChem CID | 174034142 |
| Molecular Formula | C24H24FN3OS |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 7-(aminomethylidene)-6-(4-fluorophenyl)imino-2-(3-methylphenyl)sulfanyl-1,3,4,8-tetrahydroisoquinoline-8a-carbaldehyde |
| SMILES | Cc1cccc(SN2CCC3=C/C(=N\c4ccc(F)cc4)C(=CN)CC3(C=O)C2)c1 |
| InChI | InChI=1S/C24H24FN3OS/c1-17-3-2-4-22(11-17)30-28-10-9-19-12-23(27-21-7-5-20(25)6-8-21)18(14-26)13-24(19,15-28)16-29/h2-8,11-12,14,16H,9-10,13,15,26H2,1H3/b18-14?,27-23+ |
| InChIKey | VUZHVWZYIOJZND-QTQDMJDHSA-N |
| XLogP | 4.98 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|