C22H46O8Si3 — CID 174034280
diethyl 2-[[(2R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl]propanedioate (PubChem CID 174034280) has the molecular formula C22H46O8Si3 and a molecular weight of 522.86 g/mol. Its IUPAC name is diethyl 2-[[(2R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl]propanedioate.
| Compound Name | diethyl 2-[[(2R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 174034280 |
| Molecular Formula | C22H46O8Si3 |
| Molecular Weight | 522.86 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | diethyl 2-[[(2R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl]propanedioate |
| SMILES | CCOC(=O)C(C[C@H]1OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C22H46O8Si3/c1-12-25-21(23)16(22(24)26-13-2)14-17-19(29-32(6,7)8)20(30-33(9,10)11)18(15-27-17)28-31(3,4)5/h16-20H,12-15H2,1-11H3/t17-,18?,19?,20?/m1/s1 |
| InChIKey | FOBMAIOLFHQMKI-NEYBNPPJSA-N |
| XLogP | 4.18 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|