C17H36O7Si — CID 174034293
(3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(3-hydroxy-2,3-dimethoxybutan-2-yl)oxyoxan-3-ol (PubChem CID 174034293) has the molecular formula C17H36O7Si and a molecular weight of 380.55 g/mol. Its IUPAC name is (3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(3-hydroxy-2,3-dimethoxybutan-2-yl)oxyoxan-3-ol.
| Compound Name | (3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(3-hydroxy-2,3-dimethoxybutan-2-yl)oxyoxan-3-ol |
|---|---|
| PubChem CID | 174034293 |
| Molecular Formula | C17H36O7Si |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(3-hydroxy-2,3-dimethoxybutan-2-yl)oxyoxan-3-ol |
| SMILES | COC(C)(O)C(C)(OC)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)OC[C@H]1O |
| InChI | InChI=1S/C17H36O7Si/c1-15(2,3)25(8,9)24-14-10-13(12(18)11-22-14)23-17(5,21-7)16(4,19)20-6/h12-14,18-19H,10-11H2,1-9H3/t12-,13+,14?,16?,17?/m1/s1 |
| InChIKey | XMFOFJMTNRJNGV-FPDFBPBRSA-N |
| XLogP | 2.22 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|