C19H27BF2N2O3 — CID 174034413
3-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2-methoxyethylimino)but-2-en-2-amine (PubChem CID 174034413) has the molecular formula C19H27BF2N2O3 and a molecular weight of 380.24 g/mol. Its IUPAC name is 3-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2-methoxyethylimino)but-2-en-2-amine.
| Compound Name | 3-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2-methoxyethylimino)but-2-en-2-amine |
|---|---|
| PubChem CID | 174034413 |
| Molecular Formula | C19H27BF2N2O3 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2-methoxyethylimino)but-2-en-2-amine |
| SMILES | COCC/N=C/C(=C(C)N)c1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1F |
| InChI | InChI=1S/C19H27BF2N2O3/c1-12(23)14(11-24-9-10-25-6)13-7-8-15(17(22)16(13)21)20-26-18(2,3)19(4,5)27-20/h7-8,11H,9-10,23H2,1-6H3/b14-12?,24-11+ |
| InChIKey | OEPZHVACSKALEK-FXYUMSBHSA-N |
| XLogP | 2.67 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|