C31H48O4Si — CID 174034582
methyl (E,4R)-4-[(10R,13R,17R)-10,13-dimethyl-3-oxo-11-triethylsilyloxy-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate (PubChem CID 174034582) has the molecular formula C31H48O4Si and a molecular weight of 512.81 g/mol. Its IUPAC name is methyl (E,4R)-4-[(10R,13R,17R)-10,13-dimethyl-3-oxo-11-triethylsilyloxy-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate.
| Compound Name | methyl (E,4R)-4-[(10R,13R,17R)-10,13-dimethyl-3-oxo-11-triethylsilyloxy-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate |
|---|---|
| PubChem CID | 174034582 |
| Molecular Formula | C31H48O4Si |
| Molecular Weight | 512.81 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | methyl (E,4R)-4-[(10R,13R,17R)-10,13-dimethyl-3-oxo-11-triethylsilyloxy-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate |
| SMILES | CC[Si](CC)(CC)OC1C[C@@]2(C)C(CC[C@@H]2[C@H](C)/C=C/C(=O)OC)C2C=CC3=CC(=O)CC[C@]3(C)C12 |
| InChI | InChI=1S/C31H48O4Si/c1-8-36(9-2,10-3)35-27-20-31(6)25(21(4)11-16-28(33)34-7)14-15-26(31)24-13-12-22-19-23(32)17-18-30(22,5)29(24)27/h11-13,16,19,21,24-27,29H,8-10,14-15,17-18,20H2,1-7H3/b16-11+/t21-,24?,25-,26?,27?,29?,30+,31-/m1/s1 |
| InChIKey | JJARBWRDQCJHON-KAXPTNNHSA-N |
| XLogP | 7.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.81 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|