C36H52N2O2S — CID 174035228
5-[[(2S)-2-[(E,3R,7S,8R)-7-methyl-8-(methylaminosulfanyl)non-4-en-3-yl]cyclobutyl]methyl]-3-(4-methyl-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carbaldehyde (PubChem CID 174035228) has the molecular formula C36H52N2O2S and a molecular weight of 576.89 g/mol. Its IUPAC name is 5-[[(2S)-2-[(E,3R,7S,8R)-7-methyl-8-(methylaminosulfanyl)non-4-en-3-yl]cyclobutyl]methyl]-3-(4-methyl-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carbaldehyde.
| Compound Name | 5-[[(2S)-2-[(E,3R,7S,8R)-7-methyl-8-(methylaminosulfanyl)non-4-en-3-yl]cyclobutyl]methyl]-3-(4-methyl-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carbaldehyde |
|---|---|
| PubChem CID | 174035228 |
| Molecular Formula | C36H52N2O2S |
| Molecular Weight | 576.89 g/mol |
| Exact Mass | 576.37 |
| IUPAC Name | 5-[[(2S)-2-[(E,3R,7S,8R)-7-methyl-8-(methylaminosulfanyl)non-4-en-3-yl]cyclobutyl]methyl]-3-(4-methyl-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carbaldehyde |
| SMILES | CCCc1cc(C)ccc1C1COc2ccc(C=O)cc2N(CC2CC[C@H]2[C@@H](/C=C/C[C@H](C)[C@@H](C)SNC)CC)C1 |
| InChI | InChI=1S/C36H52N2O2S/c1-7-10-30-19-25(3)13-16-34(30)32-22-38(35-20-28(23-39)14-18-36(35)40-24-32)21-31-15-17-33(31)29(8-2)12-9-11-26(4)27(5)41-37-6/h9,12-14,16,18-20,23,26-27,29,31-33,37H,7-8,10-11,15,17,21-22,24H2,1-6H3/b12-9+/t26-,27+,29+,31?,32?,33-/m0/s1 |
| InChIKey | KJTREJVROQUNHS-IVGXWBALSA-N |
| XLogP | 8.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.89 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|