C42H56BN4O27P3S4 — CID 174035302
CID 174035302 (PubChem CID 174035302) has the molecular formula C42H56BN4O27P3S4 and a molecular weight of 1280.91 g/mol.
| Compound Name | CID 174035302 |
|---|---|
| PubChem CID | 174035302 |
| Molecular Formula | C42H56BN4O27P3S4 |
| Molecular Weight | 1280.91 g/mol |
| Exact Mass | 1280.13 |
| IUPAC Name | — |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)NCCOCCOCCOCCOCCC(=O)NCC(C)(C)SSCOC4C[C@H]([B])O[C@@H]4COP(=O)(O)OP(=O)(O)OP(=O)(O)O)cc3C(=O)O)c3ccc(N)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C42H56BN4O27P3S4/c1-42(2,79-78-23-69-31-20-33(43)71-32(31)21-70-76(55,56)74-77(57,58)73-75(52,53)54)22-47-34(48)9-11-65-13-15-67-17-18-68-16-14-66-12-10-46-40(49)24-3-4-25(28(19-24)41(50)51)35-26-5-7-29(44)38(80(59,60)61)36(26)72-37-27(35)6-8-30(45)39(37)81(62,63)64/h3-8,19,31-33,44H,9-18,20-23,45H2,1-2H3,(H,46,49)(H,47,48)(H,50,51)(H,55,56)(H,57,58)(H2,52,53,54)(H,59,60,61)(H,62,63,64)/b44-29+/t31?,32-,33-/m1/s1 |
| InChIKey | ZWCXQYFPIJIPBT-BAAOBRHQSA-N |
| XLogP | 2.89 |
| TPSA | 482.45 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1280.91 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|