C23H25BFN5O — CID 174035758
CID 174035758 (PubChem CID 174035758) has the molecular formula C23H25BFN5O and a molecular weight of 417.30 g/mol.
| Compound Name | CID 174035758 |
|---|---|
| PubChem CID | 174035758 |
| Molecular Formula | C23H25BFN5O |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | — |
| SMILES | [B][C@]12C[C@H](N(C)c3ccc(-c4ccc(-n5ccnc5)cc4O)nn3)C[C@](C)(C1)[C@H](F)C2 |
| InChI | InChI=1S/C23H25BFN5O/c1-22-10-16(11-23(24,13-22)12-20(22)25)29(2)21-6-5-18(27-28-21)17-4-3-15(9-19(17)31)30-8-7-26-14-30/h3-9,14,16,20,31H,10-13H2,1-2H3/t16-,20-,22-,23+/m1/s1 |
| InChIKey | UEZHSMHLNAPXRC-NZILNVENSA-N |
| XLogP | 4.10 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|