C28H54N4O — CID 174038052
(E,2R,8R)-8-N-[[4-[(E)-1-(2-ethoxyethylamino)but-1-enyl]-5-methyl-1,2,3,6-tetrahydropyridin-2-yl]methyl]-8-N,2,4-trimethyldec-3-ene-1,8-diamine (PubChem CID 174038052) has the molecular formula C28H54N4O and a molecular weight of 462.77 g/mol. Its IUPAC name is (E,2R,8R)-8-N-[[4-[(E)-1-(2-ethoxyethylamino)but-1-enyl]-5-methyl-1,2,3,6-tetrahydropyridin-2-yl]methyl]-8-N,2,4-trimethyldec-3-ene-1,8-diamine.
| Compound Name | (E,2R,8R)-8-N-[[4-[(E)-1-(2-ethoxyethylamino)but-1-enyl]-5-methyl-1,2,3,6-tetrahydropyridin-2-yl]methyl]-8-N,2,4-trimethyldec-3-ene-1,8-diamine |
|---|---|
| PubChem CID | 174038052 |
| Molecular Formula | C28H54N4O |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 462.43 |
| IUPAC Name | (E,2R,8R)-8-N-[[4-[(E)-1-(2-ethoxyethylamino)but-1-enyl]-5-methyl-1,2,3,6-tetrahydropyridin-2-yl]methyl]-8-N,2,4-trimethyldec-3-ene-1,8-diamine |
| SMILES | CC/C=C(/NCCOCC)C1=C(C)CNC(CN(C)[C@H](CC)CCC/C(C)=C/[C@@H](C)CN)C1 |
| InChI | InChI=1S/C28H54N4O/c1-8-12-28(30-15-16-33-10-3)27-18-25(31-20-24(27)6)21-32(7)26(9-2)14-11-13-22(4)17-23(5)19-29/h12,17,23,25-26,30-31H,8-11,13-16,18-21,29H2,1-7H3/b22-17+,28-12+/t23-,25?,26-/m1/s1 |
| InChIKey | XJQWHJMWHFTECH-GGLBKOROSA-N |
| XLogP | 5.01 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|