C19H22FN5O — CID 174038149
N-[(2R,3R,5S)-1-cyano-2-ethyl-5-methylpyrrolidin-3-yl]-3-fluoro-4-(4-methylpyrazol-1-yl)benzamide (PubChem CID 174038149) has the molecular formula C19H22FN5O and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[(2R,3R,5S)-1-cyano-2-ethyl-5-methylpyrrolidin-3-yl]-3-fluoro-4-(4-methylpyrazol-1-yl)benzamide.
| Compound Name | N-[(2R,3R,5S)-1-cyano-2-ethyl-5-methylpyrrolidin-3-yl]-3-fluoro-4-(4-methylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 174038149 |
| Molecular Formula | C19H22FN5O |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-[(2R,3R,5S)-1-cyano-2-ethyl-5-methylpyrrolidin-3-yl]-3-fluoro-4-(4-methylpyrazol-1-yl)benzamide |
| SMILES | CC[C@@H]1[C@H](NC(=O)c2ccc(-n3cc(C)cn3)c(F)c2)C[C@H](C)N1C#N |
| InChI | InChI=1S/C19H22FN5O/c1-4-17-16(7-13(3)24(17)11-21)23-19(26)14-5-6-18(15(20)8-14)25-10-12(2)9-22-25/h5-6,8-10,13,16-17H,4,7H2,1-3H3,(H,23,26)/t13-,16+,17+/m0/s1 |
| InChIKey | FHVJAGZVXAEFIM-IAOVAPTHSA-N |
| XLogP | 2.77 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|