About (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole
(3R)-4-fluoro-2,3-dimethyl-3H-pyrrole (PubChem CID 174038258) has the molecular formula C6H8FN
and a molecular weight of 113.13 g/mol. Its IUPAC name is (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole.
Molecular Properties
| Compound Name | (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole |
| PubChem CID | 174038258 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole |
| SMILES | CC1=NC=C(F)[C@@H]1C |
| InChI | InChI=1S/C6H8FN/c1-4-5(2)8-3-6(4)7/h3-4H,1-2H3/t4-/m1/s1 |
| InChIKey | STYCTRDSHPCZOM-SCSAIBSYSA-N |
| XLogP | 1.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole?
The IUPAC name of (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole (CID 174038258) is (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole.
What is the SMILES notation for (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole?
The canonical SMILES for (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole is CC1=NC=C(F)[C@@H]1C.
What is the InChIKey of (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole?
The InChIKey is STYCTRDSHPCZOM-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H8FN/c1-4-5(2)8-3-6(4)7/h3-4H,1-2H3/t4-/m1/s1.
What are the key properties of (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole?
(3R)-4-fluoro-2,3-dimethyl-3H-pyrrole has a molecular weight of 113.13 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-fluoro-2,3-dimethyl-3H-pyrrole is sourced from PubChem (CID 174038258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).