About CID 174039555
CID 174039555 (PubChem CID 174039555) has the molecular formula C5H11BFS
and a molecular weight of 133.02 g/mol.
Molecular Properties
| Compound Name | CID 174039555 |
| PubChem CID | 174039555 |
| Molecular Formula | C5H11BFS |
| Molecular Weight | 133.02 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | — |
| SMILES | CSC[C@H](C)C[B]F |
| InChI | InChI=1S/C5H11BFS/c1-5(3-6-7)4-8-2/h5H,3-4H2,1-2H3/t5-/m1/s1 |
| InChIKey | DLUBPZFYSNSOCA-RXMQYKEDSA-N |
| XLogP | 1.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.02 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174039555 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174039555?
The IUPAC name of CID 174039555 (CID 174039555) is not available.
What is the SMILES notation for CID 174039555?
The canonical SMILES for CID 174039555 is CSC[C@H](C)C[B]F.
What is the InChIKey of CID 174039555?
The InChIKey is DLUBPZFYSNSOCA-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H11BFS/c1-5(3-6-7)4-8-2/h5H,3-4H2,1-2H3/t5-/m1/s1.
What are the key properties of CID 174039555?
CID 174039555 has a molecular weight of 133.02 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174039555 is sourced from PubChem (CID 174039555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).