C36H61NO7Si — CID 174039687
[(2R,3R,4S,5R,8S,9S,11S)-8-amino-11-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethoxy-2,4,12-trimethyl-1-phenylmethoxytridecan-5-yl] furan-2-carboxylate (PubChem CID 174039687) has the molecular formula C36H61NO7Si and a molecular weight of 647.97 g/mol. Its IUPAC name is [(2R,3R,4S,5R,8S,9S,11S)-8-amino-11-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethoxy-2,4,12-trimethyl-1-phenylmethoxytridecan-5-yl] furan-2-carboxylate.
| Compound Name | [(2R,3R,4S,5R,8S,9S,11S)-8-amino-11-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethoxy-2,4,12-trimethyl-1-phenylmethoxytridecan-5-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 174039687 |
| Molecular Formula | C36H61NO7Si |
| Molecular Weight | 647.97 g/mol |
| Exact Mass | 647.42 |
| IUPAC Name | [(2R,3R,4S,5R,8S,9S,11S)-8-amino-11-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethoxy-2,4,12-trimethyl-1-phenylmethoxytridecan-5-yl] furan-2-carboxylate |
| SMILES | CO[C@@H]([C@@H](C)[C@@H](CC[C@H](N)[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)C(C)C)OC)OC(=O)c1ccco1)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C36H61NO7Si/c1-25(2)32(44-45(10,11)36(5,6)7)22-33(39-8)29(37)19-20-30(43-35(38)31-18-15-21-42-31)27(4)34(40-9)26(3)23-41-24-28-16-13-12-14-17-28/h12-18,21,25-27,29-30,32-34H,19-20,22-24,37H2,1-11H3/t26-,27+,29+,30-,32+,33+,34-/m1/s1 |
| InChIKey | QWSVBRWLFFWESR-HJEHGEMWSA-N |
| XLogP | 7.87 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.97 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|