C29H29BF3N10O3P — CID 174039962
CID 174039962 (PubChem CID 174039962) has the molecular formula C29H29BF3N10O3P and a molecular weight of 664.40 g/mol.
| Compound Name | CID 174039962 |
|---|---|
| PubChem CID | 174039962 |
| Molecular Formula | C29H29BF3N10O3P |
| Molecular Weight | 664.40 g/mol |
| Exact Mass | 664.22 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cc(-c3cnn(C)c3)c(N3CCOCC3)nc2OCC(F)(F)F)nc1Nc1ccc2nccnc2c1P(C)(C)=O |
| InChI | InChI=1S/C29H29BF3N10O3P/c1-42-15-17(13-37-42)18-12-22(27(46-16-29(31,32)33)41-26(18)43-8-10-45-11-9-43)39-28-36-14-19(30)25(40-28)38-21-5-4-20-23(35-7-6-34-20)24(21)47(2,3)44/h4-7,12-15H,8-11,16H2,1-3H3,(H2,36,38,39,40) |
| InChIKey | CMZRPVRZUFZNSV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|