C23H20BN7OS2 — CID 174040705
CID 174040705 (PubChem CID 174040705) has the molecular formula C23H20BN7OS2 and a molecular weight of 485.41 g/mol.
| Compound Name | CID 174040705 |
|---|---|
| PubChem CID | 174040705 |
| Molecular Formula | C23H20BN7OS2 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | — |
| SMILES | [B]C(S)(S)n1cc2cc(-n3nc4ccc(NCC)nc4c(-c4ccc(C)nc4)c3=O)ccc2n1 |
| InChI | InChI=1S/C23H20BN7OS2/c1-3-25-19-9-8-18-21(27-19)20(14-5-4-13(2)26-11-14)22(32)31(29-18)16-6-7-17-15(10-16)12-30(28-17)23(24,33)34/h4-12,33-34H,3H2,1-2H3,(H,25,27) |
| InChIKey | BXWSXJPUCPLSPJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|