C27H34F2N7O3Si — CID 174041610
CID 174041610 (PubChem CID 174041610) has the molecular formula C27H34F2N7O3Si and a molecular weight of 570.70 g/mol.
| Compound Name | CID 174041610 |
|---|---|
| PubChem CID | 174041610 |
| Molecular Formula | C27H34F2N7O3Si |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | — |
| SMILES | COc1cc(C(=O)NC2CCN(C[Si])CC2)ccc1Nc1ncc2c(n1)N(C1CCCC1)CC(F)(F)C(=O)N2C |
| InChI | InChI=1S/C27H34F2N7O3Si/c1-34-21-14-30-26(33-23(21)36(19-5-3-4-6-19)15-27(28,29)25(34)38)32-20-8-7-17(13-22(20)39-2)24(37)31-18-9-11-35(16-40)12-10-18/h7-8,13-14,18-19H,3-6,9-12,15-16H2,1-2H3,(H,31,37)(H,30,32,33) |
| InChIKey | XWFYDIPNUXLLSM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|