About CID 174041638
CID 174041638 (PubChem CID 174041638) has the molecular formula C42H9B17O
and a molecular weight of 713.34 g/mol.
Molecular Properties
| Compound Name | CID 174041638 |
| PubChem CID | 174041638 |
| Molecular Formula | C42H9B17O |
| Molecular Weight | 713.34 g/mol |
| Exact Mass | 716.22 |
| IUPAC Name | — |
| SMILES | [B]c1c(-c2c3c([B])c([B])c([B])c([B])c3c(-c3cccc(-c4ccccc4)c3)c3c([B])c([B])c([B])c([B])c23)c([B])c2c(oc3c4c([B])c([B])c([B])c([B])c4c([B])c([B])c32)c1[B] |
| InChI | InChI=1S/C42H9B17O/c43-24-19(31(50)40(59)42-22(24)23-32(51)29(48)20-21(41(23)60-42)33(52)39(58)38(57)30(20)49)14-17-15(25(44)34(53)36(55)27(17)46)13(16-18(14)28(47)37(56)35(54)26(16)45)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| InChIKey | BZAYQDNENNGLJX-UHFFFAOYSA-N |
| XLogP | -8.46 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 713.34 |
| LogP ≤ 5 | -8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174041638 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174041638?
The IUPAC name of CID 174041638 (CID 174041638) is not available.
What is the SMILES notation for CID 174041638?
The canonical SMILES for CID 174041638 is [B]c1c(-c2c3c([B])c([B])c([B])c([B])c3c(-c3cccc(-c4ccccc4)c3)c3c([B])c([B])c([B])c([B])c23)c([B])c2c(oc3c4c([B])c([B])c([B])c([B])c4c([B])c([B])c32)c1[B].
What is the InChIKey of CID 174041638?
The InChIKey is BZAYQDNENNGLJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H9B17O/c43-24-19(31(50)40(59)42-22(24)23-32(51)29(48)20-21(41(23)60-42)33(52)39(58)38(57)30(20)49)14-17-15(25(44)34(53)36(55)27(17)46)13(16-18(14)28(47)37(56)35(54)26(16)45)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H.
What are the key properties of CID 174041638?
CID 174041638 has a molecular weight of 713.34 g/mol, XLogP of -8.46, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174041638 is sourced from PubChem (CID 174041638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).