C40H20B4N2S2 — CID 174041963
CID 174041963 (PubChem CID 174041963) has the molecular formula C40H20B4N2S2 and a molecular weight of 636.00 g/mol.
| Compound Name | CID 174041963 |
|---|---|
| PubChem CID | 174041963 |
| Molecular Formula | C40H20B4N2S2 |
| Molecular Weight | 636.00 g/mol |
| Exact Mass | 636.14 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(sc3ccc(-c4nc(-c5ccccc5-c5ccccc5)cc(-c5cccc6c5sc5ccccc56)n4)cc32)c1[B] |
| InChI | InChI=1S/C40H20B4N2S2/c41-34-33-28-19-22(17-18-32(28)48-39(33)37(44)36(43)35(34)42)40-45-29(24-12-5-4-11-23(24)21-9-2-1-3-10-21)20-30(46-40)27-15-8-14-26-25-13-6-7-16-31(25)47-38(26)27/h1-20H |
| InChIKey | IEWMKRAHNJLQHB-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.00 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|